EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:40813 - 4-methoxybenzoic acid
| Formula | C8H8O3 |
| Net Charge | 0 |
| Average Mass | 152.149 |
| Monoisotopic Mass | 152.04734 |
| SMILES | COc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10) |
| InChIKey | ZEYHEAKUIGZSGI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhododendron ferrugineum (ncbitaxon:49622) | leaf (BTO:0000713) | PubMed (21443171) | MeOH extract of CHCl3 soluble fraction of air-dried,powdered leaves,p-anisic & benzoic acid mixture |
| Ficus mucuso (ncbitaxon:309328) | fruit (BTO:0000486) | PubMed (21619045) | Methanolic extract of air-dried and powdered figs(fruits) |
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methoxybenzoic acid (CHEBI:40813) has functional parent benzoic acid (CHEBI:30746) |
| 4-methoxybenzoic acid (CHEBI:40813) has role plant metabolite (CHEBI:76924) |
| 4-methoxybenzoic acid (CHEBI:40813) is a methoxybenzoic acid (CHEBI:25238) |
| 4-methoxybenzoic acid (CHEBI:40813) is conjugate acid of 4-methoxybenzoate (CHEBI:16639) |
| Incoming Relation(s) |
| methyl p-anisate (CHEBI:86903) has functional parent 4-methoxybenzoic acid (CHEBI:40813) |
| 4-methoxybenzoate (CHEBI:16639) is conjugate base of 4-methoxybenzoic acid (CHEBI:40813) |
| IUPAC Name |
|---|
| 4-methoxybenzoic acid |
| Synonyms | Source |
|---|---|
| 4-Methoxybenzoic acid | KEGG COMPOUND |
| 4-Anisic acid | KEGG COMPOUND |
| p-methoxybenzoic acid | NIST Chemistry WebBook |
| p-anisic acid | NIST Chemistry WebBook |
| draconic acid | NIST Chemistry WebBook |
| 4-METHOXYBENZOIC ACID | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| C02519 | KEGG COMPOUND |
| ANN | PDBeChem |
| DB02795 | DrugBank |
| HMDB0001101 | HMDB |
| P-Anisic_acid | Wikipedia |
| CPD-1076 | MetaCyc |
| C00029536 | KNApSAcK |
| Citations |
|---|