EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO3 |
| Net Charge | 0 |
| Average Mass | 105.093 |
| Monoisotopic Mass | 105.04259 |
| SMILES | [NH3+][C@H](CO)C(=O)[O-] |
| InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m1/s1 |
| InChIKey | MTCFGRXMJLQNBG-UWTATZPHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-serine zwitterion (CHEBI:35247) is a serine zwitterion (CHEBI:35243) |
| D-serine zwitterion (CHEBI:35247) is enantiomer of L-serine zwitterion (CHEBI:33384) |
| D-serine zwitterion (CHEBI:35247) is tautomer of D-serine (CHEBI:16523) |
| Incoming Relation(s) |
| L-serine zwitterion (CHEBI:33384) is enantiomer of D-serine zwitterion (CHEBI:35247) |
| D-serine (CHEBI:16523) is tautomer of D-serine zwitterion (CHEBI:35247) |
| IUPAC Name |
|---|
| (2R)-2-ammonio-3-hydroxypropanoate |
| Synonym | Source |
|---|---|
| D-serine zwitterion | IUPAC |
| UniProt Name | Source |
|---|---|
| D-serine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| D-SERINE | MetaCyc |