EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8 |
| Net Charge | 0 |
| Average Mass | 128.174 |
| Monoisotopic Mass | 128.06260 |
| SMILES | c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H |
| InChIKey | UFWIBTONFRDIAS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gallus gallus (ncbitaxon:9031) | - | PubMed (27439360) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naphthalene (CHEBI:16482) has role apoptosis inhibitor (CHEBI:68494) |
| naphthalene (CHEBI:16482) has role carcinogenic agent (CHEBI:50903) |
| naphthalene (CHEBI:16482) has role environmental contaminant (CHEBI:78298) |
| naphthalene (CHEBI:16482) has role mouse metabolite (CHEBI:75771) |
| naphthalene (CHEBI:16482) has role plant metabolite (CHEBI:76924) |
| naphthalene (CHEBI:16482) has role volatile oil component (CHEBI:27311) |
| naphthalene (CHEBI:16482) is a ortho-fused bicyclic arene (CHEBI:35426) |
| naphthalene (CHEBI:16482) is a naphthalenes (CHEBI:25477) |
| Incoming Relation(s) |
| 1-naphthyl isothiocyanate (CHEBI:35455) has parent hydride naphthalene (CHEBI:16482) |
| 1,2-naphthoquinone (CHEBI:34055) has parent hydride naphthalene (CHEBI:16482) |
| 1,4-naphthoquinone (CHEBI:27418) has parent hydride naphthalene (CHEBI:16482) |
| chlorinated naphthalene (CHEBI:156062) has parent hydride naphthalene (CHEBI:16482) |
| dimethylnaphthalene (CHEBI:48853) has parent hydride naphthalene (CHEBI:16482) |
| methylnaphthalene (CHEBI:50715) has parent hydride naphthalene (CHEBI:16482) |
| naphthalene 1,2-oxide (CHEBI:52431) has parent hydride naphthalene (CHEBI:16482) |
| naphthalene-2,6-dicarboxylic acid (CHEBI:44460) has parent hydride naphthalene (CHEBI:16482) |
| naphthol (CHEBI:35682) has parent hydride naphthalene (CHEBI:16482) |
| naphthylacetic acid (CHEBI:35629) has parent hydride naphthalene (CHEBI:16482) |
| nitronaphthalene (CHEBI:50631) has parent hydride naphthalene (CHEBI:16482) |
| tetralin (CHEBI:35008) has parent hydride naphthalene (CHEBI:16482) |
| IUPAC Name |
|---|
| naphthalene |
| Synonyms | Source |
|---|---|
| naftaleno | ChEBI |
| naftalina | ChEBI |
| naphtalène | ChEBI |
| naphtaline | ChEBI |
| Naphthalen | ChEBI |
| Naphthalene | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| naphthalene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1312 | PPDB |
| C00001259 | KNApSAcK |
| C00829 | KEGG COMPOUND |
| C00829 | KEGG COMPOUND |
| c0333 | UM-BBD |
| HMDB0029751 | HMDB |
| Naphthalene | Wikipedia |
| NAPHTHALENE | MetaCyc |
| NPY | PDBeChem |
| Citations |
|---|