EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6O2 |
| Net Charge | 0 |
| Average Mass | 158.156 |
| Monoisotopic Mass | 158.03678 |
| SMILES | O=C1C=Cc2ccccc2C1=O |
| InChI | InChI=1S/C10H6O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H |
| InChIKey | KETQAJRQOHHATG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. aryl hydrocarbon receptor agonist An agonist that binds to and activates aryl hydrocarbon receptors (AhRs). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-naphthoquinone (CHEBI:34055) has parent hydride naphthalene (CHEBI:16482) |
| 1,2-naphthoquinone (CHEBI:34055) has role aryl hydrocarbon receptor agonist (CHEBI:72768) |
| 1,2-naphthoquinone (CHEBI:34055) has role carcinogenic agent (CHEBI:50903) |
| 1,2-naphthoquinone (CHEBI:34055) is a 1,2-naphthoquinones (CHEBI:132141) |
| IUPAC Name |
|---|
| naphthalene-1,2-dione |
| Synonyms | Source |
|---|---|
| 1,2-dihydro-1,2-diketo-naphthalene | ChemIDplus |
| 1,2-dihydronaphthalene-1,2-dione | ChEBI |
| 1,2-naphthalenedione | ChemIDplus |
| o-naphthoquinone | ChemIDplus |
| ortho-naphthoquinone | ChEBI |
| β-naphthoquinone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 1,2-naphthoquinone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1,2-Naphthoquinone | Wikipedia |
| C14783 | KEGG COMPOUND |
| CPD-4895 | MetaCyc |
| Citations |
|---|