EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H7NS |
| Net Charge | 0 |
| Average Mass | 185.251 |
| Monoisotopic Mass | 185.02992 |
| SMILES | S=C=Nc1cccc2ccccc12 |
| InChI | InChI=1S/C11H7NS/c13-8-12-11-7-3-5-9-4-1-2-6-10(9)11/h1-7H |
| InChIKey | JBDOSUUXMYMWQH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-naphthyl isothiocyanate (CHEBI:35455) has parent hydride naphthalene (CHEBI:16482) |
| 1-naphthyl isothiocyanate (CHEBI:35455) has role insecticide (CHEBI:24852) |
| 1-naphthyl isothiocyanate (CHEBI:35455) is a isothiocyanate (CHEBI:52221) |
| IUPAC Name |
|---|
| 1-isothiocyanatonaphthalene |
| Synonyms | Source |
|---|---|
| 1-Naphthylisothiocyanate | ChemIDplus |
| ANIT | ChemIDplus |
| alpha-Naphthyl isothiocyanate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:637868 | Beilstein |
| CAS:551-06-4 | ChemIDplus |