EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16NO5 |
| Net Charge | -1 |
| Average Mass | 218.229 |
| Monoisotopic Mass | 218.10340 |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)[O-] |
| InChI | InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)/p-1/t7-/m0/s1 |
| InChIKey | GHOKWGTUZJEAQD-ZETCQYMHSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-pantothenate (CHEBI:29032) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| (R)-pantothenate (CHEBI:29032) has role plant metabolite (CHEBI:76924) |
| (R)-pantothenate (CHEBI:29032) is a pantothenate (CHEBI:16454) |
| (R)-pantothenate (CHEBI:29032) is a vitamin B5 (CHEBI:176840) |
| (R)-pantothenate (CHEBI:29032) is conjugate base of (R)-pantothenic acid (CHEBI:46905) |
| Incoming Relation(s) |
| (R)-pantothenic acid (CHEBI:46905) is conjugate acid of (R)-pantothenate (CHEBI:29032) |
| IUPAC Name |
|---|
| 3-[(2R)-2,4-dihydroxy-3,3-dimethylbutanamido]propanoate |
| Synonyms | Source |
|---|---|
| pantothenate | ChemIDplus |
| (R)-N-(2,4-dihydroxy-3,3-dimethyl-1-oxobutyl)-β-alanine, ion(1−) | ChemIDplus |
| (R)-Pantothenate | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (R)-pantothenate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| PANTOTHENATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:775395 | Gmelin |
| Reaxys:3907450 | Reaxys |
| CAS:20938-62-9 | ChemIDplus |
| Citations |
|---|