EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22N2O3 |
| Net Charge | 0 |
| Average Mass | 350.418 |
| Monoisotopic Mass | 350.16304 |
| SMILES | [H][C@@]12C[C@@]3([H])C4=Nc5ccccc5[C@]45C[C@@H](C1[C@H]5OC(C)=O)N3[C@H](O)/C2=C/C |
| InChI | InChI=1S/C21H22N2O3/c1-3-11-12-8-15-18-21(13-6-4-5-7-14(13)22-18)9-16(23(15)20(11)25)17(12)19(21)26-10(2)24/h3-7,12,15-17,19-20,25H,8-9H2,1-2H3/b11-3+/t12-,15-,16-,17?,19+,20+,21+/m0/s1 |
| InChIKey | BERYBAUEDCRDKM-FDHUPVAHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vomilenine (CHEBI:16408) has functional parent vinorine (CHEBI:16791) |
| vomilenine (CHEBI:16408) is a hemiaminal (CHEBI:73080) |
| vomilenine (CHEBI:16408) is a indole alkaloid (CHEBI:38958) |
| Incoming Relation(s) |
| (20S)-19,20-dihydrovomilenine (CHEBI:230482) has functional parent vomilenine (CHEBI:16408) |
| 1,2-dihydrovomilenine (CHEBI:17372) has functional parent vomilenine (CHEBI:16408) |
| raucaffricine (CHEBI:17400) has functional parent vomilenine (CHEBI:16408) |
| IUPAC Name |
|---|
| 21α-hydroxy-22-norajmala-1,19-dien-17α-yl acetate |
| Synonym | Source |
|---|---|
| Vomilenine | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| vomilenine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00024322 | KNApSAcK |
| C00024338 | KNApSAcK |
| C01761 | KEGG COMPOUND |
| C01761 | KEGG COMPOUND |
| US2007212745 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:53093 | Reaxys |
| Reaxys:6985044 | Reaxys |
| Reaxys:9588723 | Reaxys |
| CAS:6880-50-8 | KEGG COMPOUND |
| Citations |
|---|