EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2O3 |
| Net Charge | 0 |
| Average Mass | 352.434 |
| Monoisotopic Mass | 352.17869 |
| SMILES | [H][C@@]12Nc3ccccc3[C@]13C[C@H]1C([C@H]3OC(C)=O)[C@@]3([H])C[C@]2([H])N1[C@H](O)/C3=C/C |
| InChI | InChI=1S/C21H24N2O3/c1-3-11-12-8-15-18-21(13-6-4-5-7-14(13)22-18)9-16(23(15)20(11)25)17(12)19(21)26-10(2)24/h3-7,12,15-20,22,25H,8-9H2,1-2H3/b11-3+/t12-,15-,16-,17?,18-,19+,20+,21+/m0/s1 |
| InChIKey | DRMGJVPVCAJMDJ-OEJJZAABSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-dihydrovomilenine (CHEBI:17372) has functional parent vomilenine (CHEBI:16408) |
| 1,2-dihydrovomilenine (CHEBI:17372) is a hemiaminal (CHEBI:73080) |
| 1,2-dihydrovomilenine (CHEBI:17372) is a indole alkaloid (CHEBI:38958) |
| IUPAC Name |
|---|
| 21α-hydroxy-22-norajmal-19-en-17α-yl acetate |
| Synonyms | Source |
|---|---|
| 1,2-Dihydrovomilenine | KEGG COMPOUND |
| 2-beta-(R)-1,2-Dihydrovomilenine | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (2R)-1,2-dihydrovomilenine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 12-DIHYDROVOMILENINE | MetaCyc |
| C11808 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10721827 | Reaxys |
| Citations |
|---|