EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2O3 |
| Net Charge | 0 |
| Average Mass | 352.434 |
| Monoisotopic Mass | 352.17869 |
| SMILES | [H][C@@]12C[C@]3([H])C4[C@@H](OC(C)=O)[C@@]5(C[C@@H]4N1[C@H](O)[C@H]3CC)C2=Nc1ccccc15 |
| InChI | InChI=1S/C21H24N2O3/c1-3-11-12-8-15-18-21(13-6-4-5-7-14(13)22-18)9-16(23(15)20(11)25)17(12)19(21)26-10(2)24/h4-7,11-12,15-17,19-20,25H,3,8-9H2,1-2H3/t11-,12-,15-,16-,17?,19+,20+,21+/m0/s1 |
| InChIKey | HQZUCSQUBHQEDH-MAPGWTOISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (20S)-19,20-dihydrovomilenine (CHEBI:230482) has functional parent vomilenine (CHEBI:16408) |
| (20S)-19,20-dihydrovomilenine (CHEBI:230482) is a hemiaminal (CHEBI:73080) |
| (20S)-19,20-dihydrovomilenine (CHEBI:230482) is a indole alkaloid (CHEBI:38958) |
| UniProt Name | Source |
|---|---|
| (20S)-19,20-dihydrovomilenine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-21573 | MetaCyc |
| Citations |
|---|