EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H40O5 |
| Net Charge | 0 |
| Average Mass | 408.579 |
| Monoisotopic Mass | 408.28757 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])C[C@H](O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)O)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C24H40O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-20,22,25-27H,4-12H2,1-3H3,(H,28,29)/t13-,14+,15-,16-,17+,18+,19-,20+,22+,23+,24-/m1/s1 |
| InChIKey | BHQCQFFYRZLCQQ-OELDTZBJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (11316487) | |
| Mus musculus (ncbitaxon:10090) | |||
| - | DOI (10.1172/JCI16309) | ||
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cholic acid (CHEBI:16359) has role human metabolite (CHEBI:77746) |
| cholic acid (CHEBI:16359) has role mouse metabolite (CHEBI:75771) |
| cholic acid (CHEBI:16359) is a 12α-hydroxy steroid (CHEBI:36846) |
| cholic acid (CHEBI:16359) is a 3α-hydroxy steroid (CHEBI:36835) |
| cholic acid (CHEBI:16359) is a 7α-hydroxy steroid (CHEBI:36843) |
| cholic acid (CHEBI:16359) is a bile acid (CHEBI:3098) |
| cholic acid (CHEBI:16359) is a C24-steroid (CHEBI:131620) |
| cholic acid (CHEBI:16359) is a trihydroxy-5β-cholanic acid (CHEBI:27114) |
| cholic acid (CHEBI:16359) is conjugate acid of cholate (CHEBI:29747) |
| Incoming Relation(s) |
| (23S)-methyl-3α,7α,12α-trihydroxy-5β-cholan-24-oic acid (CHEBI:488147) has functional parent cholic acid (CHEBI:16359) |
| N-(2-phosphonoethyl)cholamide (CHEBI:1019) has functional parent cholic acid (CHEBI:16359) |
| S-choloyl-4'-phosphopantetheine (CHEBI:132321) has functional parent cholic acid (CHEBI:16359) |
| 3-[(3-cholamidopropyl)dimethylammonio]propane-1-sulfonate (CHEBI:1418) has functional parent cholic acid (CHEBI:16359) |
| cholate salt (CHEBI:23169) has functional parent cholic acid (CHEBI:16359) |
| cholic acid 24-O-(β-D-glucuronide) (CHEBI:137791) has functional parent cholic acid (CHEBI:16359) |
| Cholic acid sulfate (CHEBI:233476) has functional parent cholic acid (CHEBI:16359) |
| choloyl-CoA (CHEBI:15519) has functional parent cholic acid (CHEBI:16359) |
| cholyl-L-tryptophan (CHEBI:232263) has functional parent cholic acid (CHEBI:16359) |
| glycochenodeoxycholic acid 7-sulfate (CHEBI:52031) has functional parent cholic acid (CHEBI:16359) |
| glycocholic acid (CHEBI:17687) has functional parent cholic acid (CHEBI:16359) |
| hyodeoxycholic acid (CHEBI:52023) has functional parent cholic acid (CHEBI:16359) |
| murideoxycholic acid (CHEBI:52030) has functional parent cholic acid (CHEBI:16359) |
| taurocholic acid (CHEBI:28865) has functional parent cholic acid (CHEBI:16359) |
| cholate (CHEBI:29747) is conjugate base of cholic acid (CHEBI:16359) |
| IUPAC Name |
|---|
| 3α,7α,12α-trihydroxy-5β-cholan-24-oic acid |
| Synonyms | Source |
|---|---|
| 3alpha,7alpha,12alpha-Trihydroxy-5beta-cholanate | KEGG COMPOUND |
| 3alpha,7alpha,12alpha-Trihydroxy-5beta-cholanic acid | KEGG COMPOUND |
| (3α,5β,7α,12α)-3,7,12-trihydroxycholan-24-oic acid | NIST Chemistry WebBook |
| 3α,7α,12α-trihydroxy-5β-cholanic acid | NIST Chemistry WebBook |
| Cholic acid | KEGG COMPOUND |
| CHOLIC ACID | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| 3096 | DrugCentral |
| C00695 | KEGG COMPOUND |
| CHD | PDBeChem |
| CHOLATE | MetaCyc |
| Cholic_Acid | Wikipedia |
| DB02659 | DrugBank |
| HMDB0000619 | HMDB |
| LMST04010001 | LIPID MAPS |
| LSM-5541 | LINCS |
| Citations |
|---|