EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O11 |
| Net Charge | 0 |
| Average Mass | 584.703 |
| Monoisotopic Mass | 584.31966 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])C[C@H](O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C30H48O11/c1-13(4-7-21(34)40-28-25(37)23(35)24(36)26(41-28)27(38)39)16-5-6-17-22-18(12-20(33)30(16,17)3)29(2)9-8-15(31)10-14(29)11-19(22)32/h13-20,22-26,28,31-33,35-37H,4-12H2,1-3H3,(H,38,39)/t13-,14+,15-,16-,17+,18+,19-,20+,22+,23+,24+,25-,26+,28-,29+,30-/m1/s1 |
| InChIKey | AIUGVBWFKAVAIZ-SXYQVCRBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (23756370) |
| Roles Classification |
|---|
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cholic acid 24-O-(β-D-glucuronide) (CHEBI:137791) has functional parent cholic acid (CHEBI:16359) |
| cholic acid 24-O-(β-D-glucuronide) (CHEBI:137791) has role human urinary metabolite (CHEBI:84087) |
| cholic acid 24-O-(β-D-glucuronide) (CHEBI:137791) is a O-acyl carbohydrate (CHEBI:52782) |
| cholic acid 24-O-(β-D-glucuronide) (CHEBI:137791) is a steroid glucosiduronic acid (CHEBI:26763) |
| cholic acid 24-O-(β-D-glucuronide) (CHEBI:137791) is a β-D-glucosiduronic acid (CHEBI:15341) |
| cholic acid 24-O-(β-D-glucuronide) (CHEBI:137791) is conjugate acid of cholic acid 24-O-(β-D-glucuronide)(1−) (CHEBI:136900) |
| Incoming Relation(s) |
| cholic acid 24-O-(β-D-glucuronide)(1−) (CHEBI:136900) is conjugate base of cholic acid 24-O-(β-D-glucuronide) (CHEBI:137791) |
| IUPAC Name |
|---|
| 1-O-(3α,7α,12α-trihydroxy-24-oxo-5β-cholan-24-yl)-β-D-glucopyranuronic acid |
| Synonyms | Source |
|---|---|
| 1-O-[(3α,5β,7α,12α)-3,7,12-trihydroxy-24-oxocholan-24-yl]-β-D-glucopyranuronic acid | IUPAC |
| CA-24G | ChEBI |
| cholic acid 24-glucuronide | ChEBI |
| cholic acid 24-β-glucuronide | ChEBI |
| cholic acid 24-β-D-glucuronide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8025077 | Reaxys |
| Citations |
|---|