EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H50N2O6 |
| Net Charge | 0 |
| Average Mass | 594.793 |
| Monoisotopic Mass | 594.36689 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])C[C@H](O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)N[C@@H](Cc3cnc4ccccc34)C(=O)O)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C35H50N2O6/c1-19(8-11-31(41)37-28(33(42)43)14-20-18-36-27-7-5-4-6-23(20)27)24-9-10-25-32-26(17-30(40)35(24,25)3)34(2)13-12-22(38)15-21(34)16-29(32)39/h4-7,18-19,21-22,24-26,28-30,32,36,38-40H,8-17H2,1-3H3,(H,37,41)(H,42,43)/t19-,21+,22-,24-,25+,26+,28+,29-,30+,32+,34+,35-/m1/s1 |
| InChIKey | UXWZMQPNSYWAHX-DMELVVMMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cholyl-L-tryptophan (CHEBI:232263) has functional parent L-tryptophan (CHEBI:16828) |
| cholyl-L-tryptophan (CHEBI:232263) has functional parent cholic acid (CHEBI:16359) |
| cholyl-L-tryptophan (CHEBI:232263) is a L-tryptophan derivative (CHEBI:47994) |
| cholyl-L-tryptophan (CHEBI:232263) is a 12α-hydroxy steroid (CHEBI:36846) |
| cholyl-L-tryptophan (CHEBI:232263) is a 3α-hydroxy steroid (CHEBI:36835) |
| cholyl-L-tryptophan (CHEBI:232263) is a 7α-hydroxy steroid (CHEBI:36843) |
| cholyl-L-tryptophan (CHEBI:232263) is a bile acid conjugate (CHEBI:36249) |
| cholyl-L-tryptophan (CHEBI:232263) is a monocarboxylic acid (CHEBI:25384) |
| cholyl-L-tryptophan (CHEBI:232263) is a secondary carboxamide (CHEBI:140325) |
| cholyl-L-tryptophan (CHEBI:232263) is conjugate acid of cholyl-L-tryptophan(1−) (CHEBI:234456) |
| Incoming Relation(s) |
| cholyl-L-tryptophan(1−) (CHEBI:234456) is conjugate base of cholyl-L-tryptophan (CHEBI:232263) |
| IUPAC Name |
|---|
| (2S)-2-[(4R)-4-[(1R,3aS,3bR,4R,5aS,7R,9aS,9bS,11S,11aR)-4,7,11-trihydroxy-9a,11a-dimethyl-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl]pentanamido]-3-(1H-indol-3-yl)propanoic acid |
| Synonyms | Source |
|---|---|
| cholyl-tryptophan | ChEBI |
| cholyltryptophan | ChEBI |
| N-(3α,7α,12α-trihydroxy-5β-cholan-24-oyl)-L-tryptophan | ChEBI |
| Nα-(24-oxo-3α,7α,12α-trihydroxy-5β-cholane-24-yl)-L-tryptophan | ChEBI |
| L-tryptophan conjugated cholic acid | ChEBI |
| L-tryptophan-conjugated cholic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0242374 | HMDB |
| Citations |
|---|