EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H44N4O16 |
| Net Charge | 0 |
| Average Mass | 776.749 |
| Monoisotopic Mass | 776.27523 |
| SMILES | [H]C(=O)NCc1cc(COc2ccc(CCNC(=O)CC[C@H](NC(=O)CC[C@H](NC(=O)CC[C@H](C(=O)O)[C@@H](CCC(=O)O)C(=O)O)C(=O)O)C(=O)O)cc2)co1 |
| InChI | InChI=1S/C35H44N4O16/c40-19-36-16-23-15-21(18-55-23)17-54-22-3-1-20(2-4-22)13-14-37-28(41)10-7-26(34(50)51)39-30(43)11-8-27(35(52)53)38-29(42)9-5-24(32(46)47)25(33(48)49)6-12-31(44)45/h1-4,15,18-19,24-27H,5-14,16-17H2,(H,36,40)(H,37,41)(H,38,42)(H,39,43)(H,44,45)(H,46,47)(H,48,49)(H,50,51)(H,52,53)/t24-,25+,26-,27-/m0/s1 |
| InChIKey | RGBIJPWAWLXPOC-XUJYPJAKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formylmethanofuran (CHEBI:16314) has functional parent methanofuran (CHEBI:17448) |
| N-formylmethanofuran (CHEBI:16314) is a pentacarboxylic acid (CHEBI:35743) |
| N-formylmethanofuran (CHEBI:16314) is conjugate acid of N-formylmethanofuran(5−) (CHEBI:57727) |
| Incoming Relation(s) |
| N-formylmethanofuran(5−) (CHEBI:57727) is conjugate base of N-formylmethanofuran (CHEBI:16314) |
| IUPAC Name |
|---|
| N2-[rel-(4R,5S)-4,5,7-tricarboxyheptanoyl]-L-γ-glutamyl-N5-[2-(4-{[5-(formamidomethyl)-3-furyl]methoxy}phenyl)ethyl]-L-glutamine |
| Synonym | Source |
|---|---|
| Formylmethanofuran | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01001 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:94483-60-0 | KEGG COMPOUND |