EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H44N4O15 |
| Net Charge | 0 |
| Average Mass | 748.739 |
| Monoisotopic Mass | 748.28032 |
| SMILES | NCc1cc(COc2ccc(CCNC(=O)CC[C@H](NC(=O)CC[C@H](NC(=O)CC[C@H](C(=O)O)[C@@H](CCC(=O)O)C(=O)O)C(=O)O)C(=O)O)cc2)co1 |
| InChI | InChI=1S/C34H44N4O15/c35-16-22-15-20(18-53-22)17-52-21-3-1-19(2-4-21)13-14-36-27(39)10-7-25(33(48)49)38-29(41)11-8-26(34(50)51)37-28(40)9-5-23(31(44)45)24(32(46)47)6-12-30(42)43/h1-4,15,18,23-26H,5-14,16-17,35H2,(H,36,39)(H,37,40)(H,38,41)(H,42,43)(H,44,45)(H,46,47)(H,48,49)(H,50,51)/t23-,24+,25-,26-/m0/s1 |
| InChIKey | CKRUWFDORAQSRC-QYOOZWMWSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methanofuran (CHEBI:17448) is a furans (CHEBI:24129) |
| methanofuran (CHEBI:17448) is conjugate acid of methanofuranate(4−) (CHEBI:58151) |
| Incoming Relation(s) |
| N-formylmethanofuran (CHEBI:16314) has functional parent methanofuran (CHEBI:17448) |
| methanofuranate(4−) (CHEBI:58151) is conjugate base of methanofuran (CHEBI:17448) |
| IUPAC Name |
|---|
| N2-[rel-(4R,5S)-4,5,7-tricarboxyheptanoyl]-L-γ-glutamyl-N5-[2-(4-{[5-(aminomethyl)-3-furyl]methoxy}phenyl)ethyl]-L-glutamine |
| Synonyms | Source |
|---|---|
| 4-[N-(4,5,7-tricarboxyheptanoyl)-γ-L-glutamyl-γ-L-glutamyl-4-(2-aminoethyl)phenoxymethyl]-2-(aminomethyl)furan | IUBMB |
| Carbon dioxide reduction factor | ChemIDplus |
| Cdr factor | ChemIDplus |
| L-Glutamine, N-(2-(4-((5-(aminomethyl)-3-furanyl)methoxy)phenyl)ethyl)-N2-(N-(4,5,7-tricarboxy-1-oxoheptyl)-L-gamma-glutamyl)- | ChemIDplus |
| Methanofuran | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00862 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:89873-36-9 | KEGG COMPOUND |
| CAS:89873-36-9 | ChemIDplus |