EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H39N4O16 |
| Net Charge | -5 |
| Average Mass | 771.709 |
| Monoisotopic Mass | 771.23885 |
| SMILES | O=CNCc1cc(COc2ccc(CCNC(=O)CC[C@H](NC(=O)CC[C@H](NC(=O)CC[C@H](C(=O)[O-])[C@@H](CCC(=O)[O-])C(=O)[O-])C(=O)[O-])C(=O)[O-])cc2)co1 |
| InChI | InChI=1S/C35H44N4O16/c40-19-36-16-23-15-21(18-55-23)17-54-22-3-1-20(2-4-22)13-14-37-28(41)10-7-26(34(50)51)39-30(43)11-8-27(35(52)53)38-29(42)9-5-24(32(46)47)25(33(48)49)6-12-31(44)45/h1-4,15,18-19,24-27H,5-14,16-17H2,(H,36,40)(H,37,41)(H,38,42)(H,39,43)(H,44,45)(H,46,47)(H,48,49)(H,50,51)(H,52,53)/p-5/t24-,25+,26-,27-/m0/s1 |
| InChIKey | RGBIJPWAWLXPOC-XUJYPJAKSA-I |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formylmethanofuran(5−) (CHEBI:57727) is a peptide anion (CHEBI:60334) |
| N-formylmethanofuran(5−) (CHEBI:57727) is conjugate base of N-formylmethanofuran (CHEBI:16314) |
| Incoming Relation(s) |
| N-formylmethanofuran (CHEBI:16314) is conjugate acid of N-formylmethanofuran(5−) (CHEBI:57727) |
| Synonym | Source |
|---|---|
| N-formylmethanofuran pentaanion | ChEBI |
| UniProt Name | Source |
|---|---|
| N-formylmethanofuran | UniProt |