EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H13O8P |
| Net Charge | 0 |
| Average Mass | 232.125 |
| Monoisotopic Mass | 232.03480 |
| SMILES | O=P(O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C5H13O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h3-9H,1-2H2,(H2,10,11,12)/t3-,4+,5-/m0/s1 |
| InChIKey | VJDOAZKNBQCAGE-LMVFSUKVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-ribitol 5-phosphate (CHEBI:16246) has functional parent ribitol (CHEBI:15963) |
| D-ribitol 5-phosphate (CHEBI:16246) is a ribitol 5-phosphate (CHEBI:37534) |
| D-ribitol 5-phosphate (CHEBI:16246) is conjugate acid of D-ribitol 5-phosphate(2−) (CHEBI:57695) |
| Incoming Relation(s) |
| prenyl-FMN (CHEBI:87749) has functional parent D-ribitol 5-phosphate (CHEBI:16246) |
| prenyl-FMNH2 (CHEBI:87531) has functional parent D-ribitol 5-phosphate (CHEBI:16246) |
| D-ribitol 5-phosphate(2−) (CHEBI:57695) is conjugate base of D-ribitol 5-phosphate (CHEBI:16246) |
| IUPAC Names |
|---|
| 5-O-phosphono-D-ribitol |
| D-ribitol 5-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| D-Ribitol 5-phosphate | KEGG COMPOUND |
| L-Ribitol 1-phosphate | KEGG COMPOUND |
| Rbt-5-P | ChEBI |
| Ribitol 5-phosphate | KEGG COMPOUND |
| Citations |
|---|