EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31N4O9P |
| Net Charge | 0 |
| Average Mass | 526.483 |
| Monoisotopic Mass | 526.18287 |
| SMILES | Cc1cc2c3c(c1C)C(C)(C)CCN3C1C(=O)NC(=O)N=C1N2C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C22H31N4O9P/c1-10-7-12-16-15(11(10)2)22(3,4)5-6-25(16)17-19(23-21(31)24-20(17)30)26(12)8-13(27)18(29)14(28)9-35-36(32,33)34/h7,13-14,17-18,27-29H,5-6,8-9H2,1-4H3,(H,24,30,31)(H2,32,33,34)/t13-,14+,17?,18-/m0/s1 |
| InChIKey | LPYXQZQRAPEQHK-YWGCOLQPSA-N |
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prenyl-FMNH2 (CHEBI:87531) has functional parent D-ribitol 5-phosphate (CHEBI:16246) |
| prenyl-FMNH2 (CHEBI:87531) has functional parent FMNH2 (CHEBI:16048) |
| prenyl-FMNH2 (CHEBI:87531) has role Escherichia coli metabolite (CHEBI:76971) |
| prenyl-FMNH2 (CHEBI:87531) has role cofactor (CHEBI:23357) |
| prenyl-FMNH2 (CHEBI:87531) is a flavin mononucleotide (CHEBI:24041) |
| prenyl-FMNH2 (CHEBI:87531) is a organic heterotetracyclic compound (CHEBI:38163) |
| prenyl-FMNH2 (CHEBI:87531) is conjugate acid of prenyl-FMNH2(2−) (CHEBI:87467) |
| Incoming Relation(s) |
| prenyl-FMNH2(2−) (CHEBI:87467) is conjugate base of prenyl-FMNH2 (CHEBI:87531) |
| IUPAC Name |
|---|
| 1-deoxy-5-O-phosphono-1-(3,3,4,5-tetramethyl-9,11-dioxo-2,3,9,10,11,11a-hexahydro-1H,7H-quinolino[1,8-fg]pteridin-7-yl)-D-ribitol |
| Synonyms | Source |
|---|---|
| prenylated FMNH2 | MetaCyc |
| prenylated reduced flavin mononucleotide | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-18260 | MetaCyc |
| Citations |
|---|