EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:155891 - dihydrogeodin
| Formula | C17H14Cl2O7 |
| Net Charge | 0 |
| Average Mass | 401.198 |
| Monoisotopic Mass | 400.01166 |
| SMILES | COC(=O)c1cc(O)cc(OC)c1C(=O)c1c(O)c(Cl)c(C)c(Cl)c1O |
| InChI | InChI=1S/C17H14Cl2O7/c1-6-12(18)15(22)11(16(23)13(6)19)14(21)10-8(17(24)26-3)4-7(20)5-9(10)25-2/h4-5,20,22-23H,1-3H3 |
| InChIKey | AXIPUIQLQUNOCF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus terreus (ncbitaxon:33178) | |||
| - | PubMed (29388436) | Strain: TM8 | |
| - | PubMed (27844127) | Strain: QT122 | |
| Aspergillus flavipes (ncbitaxon:41900) | - | PubMed (27933892) | Strain: HN4-13 |
| Trewia nudiflora (ncbitaxon:300977) | - | PubMed (19140073) |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrogeodin (CHEBI:155891) has functional parent sulochrin (CHEBI:16159) |
| dihydrogeodin (CHEBI:155891) has role Aspergillus metabolite (CHEBI:76956) |
| dihydrogeodin (CHEBI:155891) is a aromatic ether (CHEBI:35618) |
| dihydrogeodin (CHEBI:155891) is a benzophenones (CHEBI:22726) |
| dihydrogeodin (CHEBI:155891) is a dichlorobenzene (CHEBI:23697) |
| dihydrogeodin (CHEBI:155891) is a methyl ester (CHEBI:25248) |
| dihydrogeodin (CHEBI:155891) is a phenols (CHEBI:33853) |
| dihydrogeodin (CHEBI:155891) is conjugate acid of dihydrogeodin(2−) (CHEBI:150012) |
| Incoming Relation(s) |
| dihydrogeodin(2−) (CHEBI:150012) is conjugate base of dihydrogeodin (CHEBI:155891) |
| IUPAC Name |
|---|
| methyl 2-(3,5-dichloro-2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-methoxybenzoate |
| Synonyms | Source |
|---|---|
| 2-[2,6-dihydroxy-3,5-dichloro-4-methylbenzoyl]-3-methoxy-5-hydroxybenzoic acid methyl ester | ChEBI |
| 2-(3,5-dichloro-2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-methoxybenzoic acid methyl ester | ChEBI |
| Citations |
|---|