EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N4O14P3 |
| Net Charge | 0 |
| Average Mass | 508.166 |
| Monoisotopic Mass | 507.97976 |
| SMILES | O=c1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H15N4O14P3/c15-6-4(1-25-30(21,22)28-31(23,24)27-29(18,19)20)26-10(7(6)16)14-3-13-5-8(14)11-2-12-9(5)17/h2-4,6-7,10,15-16H,1H2,(H,21,22)(H,23,24)(H,11,12,17)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | HAEJPQIATWHALX-KQYNXXCUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (24227841) | |
| Mus musculus (ncbitaxon:10090) | |||
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 | |
| - | PubMed (20601097) |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ITP (CHEBI:16039) has role Escherichia coli metabolite (CHEBI:76971) |
| ITP (CHEBI:16039) has role human metabolite (CHEBI:77746) |
| ITP (CHEBI:16039) has role mouse metabolite (CHEBI:75771) |
| ITP (CHEBI:16039) is a inosine phosphate (CHEBI:24843) |
| ITP (CHEBI:16039) is a purine ribonucleoside 5'-triphosphate (CHEBI:37045) |
| ITP (CHEBI:16039) is conjugate acid of ITP(3−) (CHEBI:57614) |
| ITP (CHEBI:16039) is conjugate acid of ITP(4−) (CHEBI:61402) |
| Incoming Relation(s) |
| ethyl-ITP (CHEBI:62907) has functional parent ITP (CHEBI:16039) |
| ITP(3−) (CHEBI:57614) is conjugate base of ITP (CHEBI:16039) |
| ITP(4−) (CHEBI:61402) is conjugate base of ITP (CHEBI:16039) |
| IUPAC Name |
|---|
| inosine 5'-(tetrahydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| 2'-inosine-5'-triphosphate | ChEBI |
| O5'-(tetrahydroxytriphosphoryl)inosine | ChEBI |
| Inosine 5'-triphosphate | KEGG COMPOUND |
| Inosine triphosphate | KEGG COMPOUND |
| Inosine tripolyphosphate | KEGG COMPOUND |
| ITP | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00081 | KEGG COMPOUND |
| C00081 | KEGG COMPOUND |
| ECMDB00189 | ECMDB |
| HMDB0000189 | HMDB |
| ITP | MetaCyc |
| ITT | PDBeChem |
| YMDB00559 | YMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:600524 | Reaxys |
| CAS:132-06-9 | KEGG COMPOUND |
| Citations |
|---|