EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N4O14P3 |
| Net Charge | -3 |
| Average Mass | 505.142 |
| Monoisotopic Mass | 504.95793 |
| SMILES | O=c1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H15N4O14P3/c15-6-4(1-25-30(21,22)28-31(23,24)27-29(18,19)20)26-10(7(6)16)14-3-13-5-8(14)11-2-12-9(5)17/h2-4,6-7,10,15-16H,1H2,(H,21,22)(H,23,24)(H,11,12,17)(H2,18,19,20)/p-3/t4-,6-,7-,10-/m1/s1 |
| InChIKey | HAEJPQIATWHALX-KQYNXXCUSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ITP(3−) (CHEBI:57614) has role human metabolite (CHEBI:77746) |
| ITP(3−) (CHEBI:57614) is a ribonucleoside triphosphate oxoanion (CHEBI:59724) |
| ITP(3−) (CHEBI:57614) is conjugate base of ITP (CHEBI:16039) |
| Incoming Relation(s) |
| ITP (CHEBI:16039) is conjugate acid of ITP(3−) (CHEBI:57614) |
| IUPAC Name |
|---|
| 5'-O-[({[(hydroxyphosphinato)oxy]phosphinato}oxy)phosphinato]inosine |
| Synonyms | Source |
|---|---|
| ITP trianion | ChEBI |
| inosine triphosphate(3−) | ChEBI |
| inosine triphosphate | ChEBI |
| inosine triphosphate trianion | ChEBI |
| inosine 5'-triphosphate(3−) | ChEBI |
| inosine 5'-triphosphate trianion | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4344695 | Beilstein |