EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N4O14P3 |
| Net Charge | -4 |
| Average Mass | 504.134 |
| Monoisotopic Mass | 503.95066 |
| SMILES | O=c1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H15N4O14P3/c15-6-4(1-25-30(21,22)28-31(23,24)27-29(18,19)20)26-10(7(6)16)14-3-13-5-8(14)11-2-12-9(5)17/h2-4,6-7,10,15-16H,1H2,(H,21,22)(H,23,24)(H,11,12,17)(H2,18,19,20)/p-4/t4-,6-,7-,10-/m1/s1 |
| InChIKey | HAEJPQIATWHALX-KQYNXXCUSA-J |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ITP(4−) (CHEBI:61402) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| ITP(4−) (CHEBI:61402) is a nucleoside 5'-triphoshate(4−) (CHEBI:61557) |
| ITP(4−) (CHEBI:61402) is conjugate base of ITP (CHEBI:16039) |
| Incoming Relation(s) |
| ITP (CHEBI:16039) is conjugate acid of ITP(4−) (CHEBI:61402) |
| Synonyms | Source |
|---|---|
| inosine triphosphate(4−) | SUBMITTER |
| inosine 5'-triphosphate | SUBMITTER |
| inosine 5'-triphosphate tetraanion | ChEBI |
| ITP tetraanion | ChEBI |
| UniProt Name | Source |
|---|---|
| ITP | UniProt |
| Manual Xrefs | Databases |
|---|---|
| ITP | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5209456 | Reaxys |