EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9O3 |
| Net Charge | -1 |
| Average Mass | 129.135 |
| Monoisotopic Mass | 129.05572 |
| SMILES | CC(=O)CCCC(=O)[O-] |
| InChI | InChI=1S/C6H10O3/c1-5(7)3-2-4-6(8)9/h2-4H2,1H3,(H,8,9)/p-1 |
| InChIKey | MGTZCLMLSSAXLD-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-oxohexanoate (CHEBI:12154) has functional parent hexanoate (CHEBI:17120) |
| 5-oxohexanoate (CHEBI:12154) is a 5-oxo monocarboxylic acid anion (CHEBI:35975) |
| 5-oxohexanoate (CHEBI:12154) is a medium-chain fatty acid anion (CHEBI:59558) |
| 5-oxohexanoate (CHEBI:12154) is a oxo fatty acid anion (CHEBI:59836) |
| 5-oxohexanoate (CHEBI:12154) is conjugate base of 5-oxohexanoic acid (CHEBI:15888) |
| Incoming Relation(s) |
| 5-oxohexanoic acid (CHEBI:15888) is conjugate acid of 5-oxohexanoate (CHEBI:12154) |
| IUPAC Name |
|---|
| 5-oxohexanoate |
| Synonyms | Source |
|---|---|
| 4-acetylbutyrate | ChEBI |
| 5-ketocaproate | ChEBI |
| 5-ketohexanoate | ChEBI |
| γ-acetylbutyrate | ChEBI |
| δ-ketocaproate | ChEBI |
| δ-oxocaproate | ChEBI |
| UniProt Name | Source |
|---|---|
| 5-oxohexanoate | UniProt |