EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O9 |
| Net Charge | 0 |
| Average Mass | 268.218 |
| Monoisotopic Mass | 268.07943 |
| SMILES | O=C(O)[C@@H](CO)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a1122h-1a_1-5_1*OC^RCO/4=O/3CO]/1/ |
| InChI | InChI=1S/C9H16O9/c10-1-3-5(12)6(13)7(14)9(17-3)18-4(2-11)8(15)16/h3-7,9-14H,1-2H2,(H,15,16)/t3-,4-,5-,6+,7+,9-/m1/s1 |
| InChIKey | DDXCFDOPXBPUJC-SAYMMRJXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(α-D-mannosyl)-D-glyceric acid (CHEBI:15847) has functional parent α-D-mannose (CHEBI:28729) |
| 2-(α-D-mannosyl)-D-glyceric acid (CHEBI:15847) has role Escherichia coli metabolite (CHEBI:76971) |
| 2-(α-D-mannosyl)-D-glyceric acid (CHEBI:15847) is a D-mannosyl-D-glyceric acid (CHEBI:60940) |
| 2-(α-D-mannosyl)-D-glyceric acid (CHEBI:15847) is conjugate acid of 2-(α-D-mannosyl)-D-glycerate (CHEBI:57541) |
| Incoming Relation(s) |
| 2-O-(6-phosphono-α-D-mannosyl)-D-glyceric acid (CHEBI:61001) has functional parent 2-(α-D-mannosyl)-D-glyceric acid (CHEBI:15847) |
| 2-(α-D-mannosyl)-D-glycerate (CHEBI:57541) is conjugate base of 2-(α-D-mannosyl)-D-glyceric acid (CHEBI:15847) |
| IUPAC Name |
|---|
| (2R)-3-hydroxy-2-(α-D-mannopyranosyloxy)propanoic acid |
| Synonyms | Source |
|---|---|
| 2(alpha-D-Mannosyl)-D-glycerate | KEGG COMPOUND |
| 2-O-alpha-Mannosyl-D-glycerate | KEGG COMPOUND |
| alpha-Mannosylglycerate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11544 | KEGG COMPOUND |