EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17O12P |
| Net Charge | 0 |
| Average Mass | 348.197 |
| Monoisotopic Mass | 348.04576 |
| SMILES | O=C(O)[C@@H](CO)O[C@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H17O12P/c10-1-3(8(14)15)20-9-7(13)6(12)5(11)4(21-9)2-19-22(16,17)18/h3-7,9-13H,1-2H2,(H,14,15)(H2,16,17,18)/t3-,4-,5-,6+,7+,9+/m1/s1 |
| InChIKey | BOLXAGHGKNGVBE-MTXRGOKVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-O-(6-phosphono-α-D-mannosyl)-D-glyceric acid (CHEBI:61001) has functional parent 2-(α-D-mannosyl)-D-glyceric acid (CHEBI:15847) |
| 2-O-(6-phosphono-α-D-mannosyl)-D-glyceric acid (CHEBI:61001) is a carbohydrate acid derivative (CHEBI:63436) |
| 2-O-(6-phosphono-α-D-mannosyl)-D-glyceric acid (CHEBI:61001) is a monocarboxylic acid (CHEBI:25384) |
| 2-O-(6-phosphono-α-D-mannosyl)-D-glyceric acid (CHEBI:61001) is conjugate acid of 2-O-(6-phospho-α-D-mannosyl)-D-glycerate (CHEBI:60331) |
| Incoming Relation(s) |
| 2-O-(6-phospho-α-D-mannosyl)-D-glycerate (CHEBI:60331) is conjugate base of 2-O-(6-phosphono-α-D-mannosyl)-D-glyceric acid (CHEBI:61001) |
| IUPAC Name |
|---|
| (2R)-3-hydroxy-2-[(6-O-phosphono-α-D-mannopyranosyl)oxy]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C16699 | KEGG COMPOUND |