EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N4O2 |
| Net Charge | 0 |
| Average Mass | 174.204 |
| Monoisotopic Mass | 174.11168 |
| SMILES | N=C(N)NCCC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m1/s1 |
| InChIKey | ODKSFYDXXFIFQN-SCSAIBSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 4.1.1.19 (arginine decarboxylase) inhibitor An EC 4.1.1.* (carboxy-lyase) inhibitor that interferes with the action of arginine decarboxylase (EC 4.1.1.19). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-arginine (CHEBI:15816) has role EC 4.1.1.19 (arginine decarboxylase) inhibitor (CHEBI:65053) |
| D-arginine (CHEBI:15816) has role mouse metabolite (CHEBI:75771) |
| D-arginine (CHEBI:15816) is a D-α-amino acid (CHEBI:16733) |
| D-arginine (CHEBI:15816) is a arginine (CHEBI:29016) |
| D-arginine (CHEBI:15816) is conjugate acid of D-argininate (CHEBI:32688) |
| D-arginine (CHEBI:15816) is conjugate base of D-argininium(1+) (CHEBI:32689) |
| D-arginine (CHEBI:15816) is enantiomer of L-arginine (CHEBI:16467) |
| Incoming Relation(s) |
| D-arginine derivative (CHEBI:83966) has functional parent D-arginine (CHEBI:15816) |
| vanchrobactin (CHEBI:157682) has functional parent D-arginine (CHEBI:15816) |
| D-argininium(1+) (CHEBI:32689) is conjugate acid of D-arginine (CHEBI:15816) |
| D-argininate (CHEBI:32688) is conjugate base of D-arginine (CHEBI:15816) |
| L-arginine (CHEBI:16467) is enantiomer of D-arginine (CHEBI:15816) |
| N2-D-arginino group (CHEBI:32693) is substituent group from D-arginine (CHEBI:15816) |
| Nω-D-arginino group (CHEBI:32694) is substituent group from D-arginine (CHEBI:15816) |
| D-arginine residue (CHEBI:29953) is substituent group from D-arginine (CHEBI:15816) |
| D-arginyl group (CHEBI:32691) is substituent group from D-arginine (CHEBI:15816) |
| IUPAC Name |
|---|
| D-arginine |
| Synonyms | Source |
|---|---|
| D-Arginine | KEGG COMPOUND |
| D-2-Amino-5-guanidinovaleric acid | KEGG COMPOUND |
| (2R)-2-amino-5-guanidinopentanoic acid | JCBN |
| (R)-2-amino-5-guanidinopentanoic acid | ChEBI |
| (2R)-2-amino-5-(carbamimidamido)pentanoic acid | IUPAC |
| D-Arginin | ChEBI |
| Citations |
|---|