EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29N2O |
| Net Charge | +1 |
| Average Mass | 337.487 |
| Monoisotopic Mass | 337.22744 |
| SMILES | NC(=O)C(CC[NH+]1CCCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O/c23-21(25)22(19-11-5-3-6-12-19,20-13-7-4-8-14-20)15-18-24-16-9-1-2-10-17-24/h3-8,11-14H,1-2,9-10,15-18H2,(H2,23,25)/p+1 |
| InChIKey | SLJXUJZUTPFXRJ-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| buzepide(1+) (CHEBI:157622) is a tertiary ammonium ion (CHEBI:137982) |
| buzepide(1+) (CHEBI:157622) is conjugate acid of buzepide (CHEBI:157619) |
| Incoming Relation(s) |
| buzepide metiodide (CHEBI:135429) has part buzepide(1+) (CHEBI:157622) |
| buzepide (CHEBI:157619) is conjugate base of buzepide(1+) (CHEBI:157622) |
| IUPAC Name |
|---|
| 1-(4-amino-4-oxo-3,3-diphenylbutyl)azepanium |
| Synonyms | Source |
|---|---|
| 1-(4-amino-4-oxo-3,3-diphenylbutyl)azepan-1-ium | IUPAC |
| buzepide cation | ChEBI |