EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:157619 - buzepide
| Formula | C22H28N2O |
| Net Charge | 0 |
| Average Mass | 336.479 |
| Monoisotopic Mass | 336.22016 |
| SMILES | NC(=O)C(CCN1CCCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O/c23-21(25)22(19-11-5-3-6-12-19,20-13-7-4-8-14-20)15-18-24-16-9-1-2-10-17-24/h3-8,11-14H,1-2,9-10,15-18H2,(H2,23,25) |
| InChIKey | SLJXUJZUTPFXRJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | mydriatic agent Agent that dilates the pupil. Used in eye diseases and to facilitate eye examination. It may be either a sympathomimetic or parasympatholytic. The latter cause cycloplegia or paralysis of accommodation at high doses and may precipitate glaucoma. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| buzepide (CHEBI:157619) has role cholinergic antagonist (CHEBI:48873) |
| buzepide (CHEBI:157619) has role mydriatic agent (CHEBI:50513) |
| buzepide (CHEBI:157619) is a azepanes (CHEBI:46986) |
| buzepide (CHEBI:157619) is a benzenes (CHEBI:22712) |
| buzepide (CHEBI:157619) is a primary carboxamide (CHEBI:140324) |
| buzepide (CHEBI:157619) is a tertiary amino compound (CHEBI:50996) |
| buzepide (CHEBI:157619) is conjugate base of buzepide(1+) (CHEBI:157622) |
| Incoming Relation(s) |
| buzepide(1+) (CHEBI:157622) is conjugate acid of buzepide (CHEBI:157619) |
| IUPAC Name |
|---|
| 4-(azepan-1-yl)-2,2-diphenylbutanamide |
| Synonyms | Source |
|---|---|
| buzepidonum | ChemIDplus |
| hexahydro-α,α-diphenyl-1H-azepine-1-butanamide | ChEBI |
| hexahydro-α,α-diphenyl-1H-azepine-1-butyramide | ChEBI |
| hexamethamide | ChEBI |
| 4-(hexahydro-1H-azepinyl)-2,2-diphenylbutanamide | ChEBI |
| Calmacid | ChEBI |
| Citations |
|---|