EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:135429 - buzepide metiodide
| Formula | C23H31N2O.I |
| Net Charge | 0 |
| Average Mass | 478.418 |
| Monoisotopic Mass | 478.14811 |
| SMILES | C[N+]1(CCC(C(N)=O)(c2ccccc2)c2ccccc2)CCCCCC1.[I-] |
| InChI | InChI=1S/C23H30N2O.HI/c1-25(17-10-2-3-11-18-25)19-16-23(22(24)26,20-12-6-4-7-13-20)21-14-8-5-9-15-21;/h4-9,12-15H,2-3,10-11,16-19H2,1H3,(H-,24,26);1H |
| InChIKey | HMFBCJNMIYZRKQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| buzepide metiodide (CHEBI:135429) has part buzepide(1+) (CHEBI:157622) |
| buzepide metiodide (CHEBI:135429) has role antispasmodic drug (CHEBI:53784) |
| buzepide metiodide (CHEBI:135429) has role cholinergic antagonist (CHEBI:48873) |
| buzepide metiodide (CHEBI:135429) is a organic iodide salt (CHEBI:50356) |
| IUPAC Name |
|---|
| 1-(4-amino-4-oxo-3,3-diphenylbutyl)-1-methylazepanium iodide |
| INNs | Source |
|---|---|
| buzepide metiodide | WHO MedNet |
| metioduro de buzepida | WHO MedNet |
| métiodure de buzépide | WHO MedNet |
| buzepidi metiodidum | WHO MedNet |
| Synonyms | Source |
|---|---|
| difexamide methiodide | DrugCentral |
| diphexamide iodomethylate | DrugCentral |
| metazepium iodide | DrugCentral |
| 1-(4-amino-4-oxo-3,3-diphenylbutyl)-1-methylazepan-1-ium iodide | IUPAC |
| buzepide methiodide | ChemIDplus |
| diphexamide methiodide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 459 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:15351-05-0 | ChemIDplus |
| Citations |
|---|