EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15738 - staurosporine
| Formula | C28H26N4O3 |
| Net Charge | 0 |
| Average Mass | 466.541 |
| Monoisotopic Mass | 466.20049 |
| SMILES | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4 |
| InChI | InChI=1S/C28H26N4O3/c1-28-26(34-3)17(29-2)12-20(35-28)31-18-10-6-4-8-14(18)22-23-16(13-30-27(23)33)21-15-9-5-7-11-19(15)32(28)25(21)24(22)31/h4-11,17,20,26,29H,12-13H2,1-3H3,(H,30,33)/t17-,20-,26-,28+/m1/s1 |
| InChIKey | HKSZLNNOFSGOKW-FYTWVXJKSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lentzea albida (ncbitaxon:65499) | - | DOI (10.7164/antibiotics.30.275) | Species also known as Streptomyces staurosporeus. |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.11.13 (protein kinase C) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of protein kinase C (EC 2.7.11.13). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| staurosporine (CHEBI:15738) has role apoptosis inducer (CHEBI:68495) |
| staurosporine (CHEBI:15738) has role bacterial metabolite (CHEBI:76969) |
| staurosporine (CHEBI:15738) has role EC 2.7.11.13 (protein kinase C) inhibitor (CHEBI:37700) |
| staurosporine (CHEBI:15738) has role geroprotector (CHEBI:176497) |
| staurosporine (CHEBI:15738) is a indolocarbazole alkaloid (CHEBI:37697) |
| staurosporine (CHEBI:15738) is a organic heterooctacyclic compound (CHEBI:38165) |
| staurosporine (CHEBI:15738) is conjugate base of staurosporinium (CHEBI:57491) |
| Incoming Relation(s) |
| 3'-demethylstaurosporine (CHEBI:15692) has functional parent staurosporine (CHEBI:15738) |
| 7-oxo-3,8,9-trihydroxy staurosporine (CHEBI:66839) has functional parent staurosporine (CHEBI:15738) |
| 7-oxo-8,9-dihydroxy-4'-N-demethyl staurosporine (CHEBI:66840) has functional parent staurosporine (CHEBI:15738) |
| linkable staurosporine analogue (CHEBI:39082) has functional parent staurosporine (CHEBI:15738) |
| midostaurin (CHEBI:63452) has functional parent staurosporine (CHEBI:15738) |
| staurosporinium (CHEBI:57491) is conjugate acid of staurosporine (CHEBI:15738) |
| IUPAC Name |
|---|
| (5S,6R,7R,9R)-6-methoxy-5-methyl-7-methylamino-6,7,8,9,15,16-hexahydro-5H,14H-5,9-epoxy-4b,9a,15-triazadibenzo[b,h]cyclonona[1,2,3,4-jkl]cyclopenta[e]-as-indacen-14-one |
| Synonyms | Source |
|---|---|
| Staurosporine | KEGG COMPOUND |
| (+)-Staurosporine | ChemIDplus |
| Staurosporin | ChemIDplus |
| STS | KEGG COMPOUND |
| AM-2282 | ChemIDplus |
| antibiotic AM 2282 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:62996-74-1 | KEGG COMPOUND |
| CAS:62996-74-1 | ChemIDplus |
| Citations |
|---|