EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H24N4O7 |
| Net Charge | 0 |
| Average Mass | 528.521 |
| Monoisotopic Mass | 528.16450 |
| SMILES | [H][C@]12C[C@@H](NC)[C@@H](OC)[C@](C)(O1)n1c3ccc(O)c(O)c3c3c4c(c5c6cc(O)ccc6n2c5c31)C(=O)NC4=O |
| InChI | InChI=1S/C28H24N4O7/c1-28-25(38-3)12(29-2)9-16(39-28)31-13-5-4-10(33)8-11(13)17-20-21(27(37)30-26(20)36)19-18-14(6-7-15(34)24(18)35)32(28)23(19)22(17)31/h4-8,12,16,25,29,33-35H,9H2,1-3H3,(H,30,36,37)/t12-,16-,25-,28+/m1/s1 |
| InChIKey | VDHMIDRUYQWJMP-WSDGDUIDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cystodytes solitus (WORMS:250443) | - | PubMed (18484775) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-oxo-3,8,9-trihydroxy staurosporine (CHEBI:66839) has functional parent staurosporine (CHEBI:15738) |
| 7-oxo-3,8,9-trihydroxy staurosporine (CHEBI:66839) has role antineoplastic agent (CHEBI:35610) |
| 7-oxo-3,8,9-trihydroxy staurosporine (CHEBI:66839) has role metabolite (CHEBI:25212) |
| 7-oxo-3,8,9-trihydroxy staurosporine (CHEBI:66839) is a indolocarbazole (CHEBI:51915) |
| 7-oxo-3,8,9-trihydroxy staurosporine (CHEBI:66839) is a indolocarbazole alkaloid (CHEBI:37697) |
| 7-oxo-3,8,9-trihydroxy staurosporine (CHEBI:66839) is a organic heterooctacyclic compound (CHEBI:38165) |
| 7-oxo-3,8,9-trihydroxy staurosporine (CHEBI:66839) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (5S,6R,7R,9R)-1,2,12-trihydroxy-6-methoxy-5-methyl-7-(methylamino)-6,7,8,9-tetrahydro-5H,14H-5,9-epoxy-4b,9a,15-triazadibenzo[b,h]cyclonona[1,2,3,4-jkl]cyclopenta[e]-as-indacene-14,16(15H)-dione |
| Synonym | Source |
|---|---|
| (2S,3R,4R,6R)-11,22,23-trihydroxy-3-methoxy-2-methyl-4-(methylamino)-29-oxa-1,7,17-triazaoctacyclo[12.12.2.1[2,6].0[7,28].0[8,13].0[15,19].0[20,27].0[21,26]]nonacosa-8,10,12,14,19,21,23,25,27-nonaene- 16,18-dione | ChEBI |
| Citations |
|---|