EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H30N4O4 |
| Net Charge | 0 |
| Average Mass | 570.649 |
| Monoisotopic Mass | 570.22671 |
| SMILES | CO[C@@H]1[C@H](N(C)C(=O)c2ccccc2)C[C@H]2O[C@]1(C)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4 |
| InChI | InChI=1S/C35H30N4O4/c1-35-32(42-3)25(37(2)34(41)19-11-5-4-6-12-19)17-26(43-35)38-23-15-9-7-13-20(23)28-29-22(18-36-33(29)40)27-21-14-8-10-16-24(21)39(35)31(27)30(28)38/h4-16,25-26,32H,17-18H2,1-3H3,(H,36,40)/t25-,26-,32-,35+/m1/s1 |
| InChIKey | BMGQWWVMWDBQGC-IIFHNQTCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.13 (protein kinase C) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of protein kinase C (EC 2.7.11.13). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| midostaurin (CHEBI:63452) has functional parent staurosporine (CHEBI:15738) |
| midostaurin (CHEBI:63452) has role antineoplastic agent (CHEBI:35610) |
| midostaurin (CHEBI:63452) has role EC 2.7.11.13 (protein kinase C) inhibitor (CHEBI:37700) |
| midostaurin (CHEBI:63452) is a benzamides (CHEBI:22702) |
| midostaurin (CHEBI:63452) is a indolocarbazole (CHEBI:51915) |
| midostaurin (CHEBI:63452) is a organic heterooctacyclic compound (CHEBI:38165) |
| midostaurin (CHEBI:63452) is a γ-lactam (CHEBI:74222) |
| IUPAC Name |
|---|
| N-[(5S,6R,7R,9R)-6-methoxy-5-methyl-14-oxo-6,7,8,9,15,16-hexahydro-5H,14H-5,9-epoxy-4b,9a,15-triazadibenzo[b,h]cyclonona[1,2,3,4-jkl]cyclopenta[e]-as-indacen-7-yl]-N-methylbenzamide |
| INN | Source |
|---|---|
| midostaurin | ChemIDplus |
| Synonyms | Source |
|---|---|
| CGP 41251 | ChemIDplus |
| CGP-41251 | ChemIDplus |
| 4'-N-benzoylstaurosporine | ChemIDplus |
| PKC 412 | ChemIDplus |
| PKC412 | ChemIDplus |
| benzoylstaurosporine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Midostaurin | Wikipedia |
| D05029 | KEGG DRUG |
| LSM-2287 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7345336 | Reaxys |
| CAS:120685-11-2 | ChemIDplus |
| Citations |
|---|