EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29O5 |
| Net Charge | -1 |
| Average Mass | 397.491 |
| Monoisotopic Mass | 397.20205 |
| SMILES | [H][C@]12c3cccc(CCCC(=O)[O-])c3O[C@@]1([H])C[C@@H](O)[C@]2([H])/C=C/[C@@H](O)C(C)CC#CC |
| InChI | InChI=1S/C24H30O5/c1-3-4-7-15(2)19(25)13-12-17-20(26)14-21-23(17)18-10-5-8-16(24(18)29-21)9-6-11-22(27)28/h5,8,10,12-13,15,17,19-21,23,25-26H,6-7,9,11,14H2,1-2H3,(H,27,28)/p-1/b13-12+/t15?,17-,19+,20+,21-,23-/m0/s1 |
| InChIKey | CTPOHARTNNSRSR-APJZLKAGSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| beraprost(1−) (CHEBI:156557) is a monocarboxylic acid anion (CHEBI:35757) |
| beraprost(1−) (CHEBI:156557) is conjugate base of beraprost (CHEBI:135633) |
| Incoming Relation(s) |
| beraprost sodium (CHEBI:31270) has part beraprost(1−) (CHEBI:156557) |
| beraprost (CHEBI:135633) is conjugate acid of beraprost(1−) (CHEBI:156557) |
| IUPAC Name |
|---|
| 4-{(1R,2R,3aS,8bS)-2-hydroxy-1-[(1E,3S)-3-hydroxy-4-methyloct-1-en-6-yn-1-yl]-2,3,3a,8b-tetrahydro-1H-benzo[b]cyclopenta[d]furan-5-yl}butanoate |
| Synonym | Source |
|---|---|
| beraprost anion | ChEBI |