EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29O5.Na |
| Net Charge | 0 |
| Average Mass | 420.481 |
| Monoisotopic Mass | 420.19127 |
| SMILES | [H][C@]12c3cccc(CCCC(=O)[O-])c3O[C@@]1([H])C[C@@H](O)[C@]2([H])/C=C/[C@@H](O)C(C)CC#CC.[Na+] |
| InChI | InChI=1S/C24H30O5.Na/c1-3-4-7-15(2)19(25)13-12-17-20(26)14-21-23(17)18-10-5-8-16(24(18)29-21)9-6-11-22(27)28;/h5,8,10,12-13,15,17,19-21,23,25-26H,6-7,9,11,14H2,1-2H3,(H,27,28);/q;+1/p-1/b13-12+;/t15?,17-,19+,20+,21-,23-;/m0./s1 |
| InChIKey | YTCZZXIRLARSET-VJRSQJMHSA-M |
| Roles Classification |
|---|
| Biological Role: | prostaglandin receptor agonist An agonist that binds to and activates prostaglandin receptors. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| beraprost sodium (CHEBI:31270) has part beraprost(1−) (CHEBI:156557) |
| beraprost sodium (CHEBI:31270) has role anti-inflammatory agent (CHEBI:67079) |
| beraprost sodium (CHEBI:31270) has role antihypertensive agent (CHEBI:35674) |
| beraprost sodium (CHEBI:31270) has role platelet aggregation inhibitor (CHEBI:50427) |
| beraprost sodium (CHEBI:31270) has role prostaglandin receptor agonist (CHEBI:66900) |
| beraprost sodium (CHEBI:31270) has role vasodilator agent (CHEBI:35620) |
| beraprost sodium (CHEBI:31270) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 4-{(1R,2R,3aS,8bS)-2-hydroxy-1-[(1E,3S)-3-hydroxy-4-methyloct-1-en-6-yn-1-yl]-2,3,3a,8b-tetrahydro-1H-benzo[b]cyclopenta[d]furan-5-yl}butanoate |
| Synonyms | Source |
|---|---|
| beraprost Na | ChEBI |
| beraprost sodium | KEGG COMPOUND |
| TRK 100 | ChEBI |
| TRK-100 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Beracle | ChEBI |
| Berasil | ChEBI |
| Berast | ChEBI |
| Berastolin | ChEBI |
| Berasus LA | ChEBI |
| Careload LA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D01551 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:88475-69-8 | ChemIDplus |
| Citations |
|---|