EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O5 |
| Net Charge | 0 |
| Average Mass | 398.499 |
| Monoisotopic Mass | 398.20932 |
| SMILES | [H][C@]12c3cccc(CCCC(=O)O)c3O[C@@]1([H])C[C@@H](O)[C@]2([H])/C=C/[C@@H](O)C(C)CC#CC |
| InChI | InChI=1S/C24H30O5/c1-3-4-7-15(2)19(25)13-12-17-20(26)14-21-23(17)18-10-5-8-16(24(18)29-21)9-6-11-22(27)28/h5,8,10,12-13,15,17,19-21,23,25-26H,6-7,9,11,14H2,1-2H3,(H,27,28)/b13-12+/t15?,17-,19+,20+,21-,23-/m0/s1 |
| InChIKey | CTPOHARTNNSRSR-APJZLKAGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | prostaglandin receptor agonist An agonist that binds to and activates prostaglandin receptors. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. vasodilator agent A drug used to cause dilation of the blood vessels. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| beraprost (CHEBI:135633) has role anti-inflammatory agent (CHEBI:67079) |
| beraprost (CHEBI:135633) has role anticoagulant (CHEBI:50249) |
| beraprost (CHEBI:135633) has role antihypertensive agent (CHEBI:35674) |
| beraprost (CHEBI:135633) has role platelet aggregation inhibitor (CHEBI:50427) |
| beraprost (CHEBI:135633) has role prostaglandin receptor agonist (CHEBI:66900) |
| beraprost (CHEBI:135633) has role vasodilator agent (CHEBI:35620) |
| beraprost (CHEBI:135633) is a enyne (CHEBI:59831) |
| beraprost (CHEBI:135633) is a monocarboxylic acid (CHEBI:25384) |
| beraprost (CHEBI:135633) is a organic heterotricyclic compound (CHEBI:26979) |
| beraprost (CHEBI:135633) is a secondary alcohol (CHEBI:35681) |
| beraprost (CHEBI:135633) is a secondary allylic alcohol (CHEBI:134396) |
| beraprost (CHEBI:135633) is conjugate acid of beraprost(1−) (CHEBI:156557) |
| Incoming Relation(s) |
| beraprost(1−) (CHEBI:156557) is conjugate base of beraprost (CHEBI:135633) |
| IUPAC Name |
|---|
| 4-{(1R,2R,3aS,8bS)-2-hydroxy-1-[(1E,3S)-3-hydroxy-4-methyloct-1-en-6-yn-1-yl]-2,3,3a,8b-tetrahydro-1H-benzo[b]cyclopenta[d]furan-5-yl}butanoic acid |
| INNs | Source |
|---|---|
| beraprost | WHO MedNet |
| beraprost | WHO MedNet |
| béraprost | WHO MedNet |
| beraprostum | WHO MedNet |
| Synonyms | Source |
|---|---|
| MDL 201229 | ChemIDplus |
| MDL-201229 | ChemIDplus |
| MDL201229 | ChEBI |
| ML 1229 | ChemIDplus |
| ML-1229 | ChemIDplus |
| ML1229 | ChEBI |
| Citations |
|---|