EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O4 |
| Net Charge | 0 |
| Average Mass | 312.450 |
| Monoisotopic Mass | 312.23006 |
| SMILES | CCCCCC(/C=C/C=C\CCCCCCCC(=O)O)OO |
| InChI | InChI=1S/C18H32O4/c1-2-3-11-14-17(22-21)15-12-9-7-5-4-6-8-10-13-16-18(19)20/h7,9,12,15,17,21H,2-6,8,10-11,13-14,16H2,1H3,(H,19,20)/b9-7-,15-12+ |
| InChIKey | JDSRHVWSAMTSSN-BSZOFBHHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (10542053) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-HPODE (CHEBI:91272) has role human xenobiotic metabolite (CHEBI:76967) |
| 13-HPODE (CHEBI:91272) is a HPODE (CHEBI:36329) |
| 13-HPODE (CHEBI:91272) is conjugate acid of 13-HPODE(1−) (CHEBI:90823) |
| Incoming Relation(s) |
| (13R)-HPODE (CHEBI:39573) is a 13-HPODE (CHEBI:91272) |
| 13(S)-HPODE (CHEBI:15655) is a 13-HPODE (CHEBI:91272) |
| 13-HPODE(1−) (CHEBI:90823) is conjugate base of 13-HPODE (CHEBI:91272) |
| IUPAC Name |
|---|
| (9Z,11E)-13-hydroperoxyoctadeca-9,11-dienoic acid |
| Synonyms | Source |
|---|---|
| 13-Hpod | ChemIDplus |
| 13-Hydroperoxy-9,11-octadecadienoic acid | ChemIDplus |
| 13-hydroperoxy-(9Z,11E)-octadecadienoic acid | ChEBI |
| 13-Hydroperoxyoctadeca-cis-9,trans-11-dienoic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2334490 | Reaxys |
| CAS:23017-93-8 | ChemIDplus |
| Citations |
|---|