EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O4 |
| Net Charge | 0 |
| Average Mass | 266.337 |
| Monoisotopic Mass | 266.15181 |
| SMILES | [H][C@]12CC=C(C)C[C@H](O)[C@]1(C)[C@H](O)C/C2=C(/C)C(=O)O |
| InChI | InChI=1S/C15H22O4/c1-8-4-5-11-10(9(2)14(18)19)7-13(17)15(11,3)12(16)6-8/h4,11-13,16-17H,5-7H2,1-3H3,(H,18,19)/b10-9+/t11-,12+,13-,15-/m1/s1 |
| InChIKey | SFKVYZKKPMSRCR-JBOWGTNDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asperaculane G (CHEBI:156268) has role Aspergillus metabolite (CHEBI:76956) |
| asperaculane G (CHEBI:156268) is a carbobicyclic compound (CHEBI:36785) |
| asperaculane G (CHEBI:156268) is a homoallylic alcohol (CHEBI:134362) |
| asperaculane G (CHEBI:156268) is a sesquiterpenoid (CHEBI:26658) |
| asperaculane G (CHEBI:156268) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| asperaculane G (CHEBI:156268) is conjugate acid of asperaculane G(1−) (CHEBI:155911) |
| Incoming Relation(s) |
| asperaculane G(1−) (CHEBI:155911) is conjugate base of asperaculane G (CHEBI:156268) |
| IUPAC Name |
|---|
| (2E)-2-[(3R,3aR,4S,8aR)-3,4-dihydroxy-3a,6-dimethyl-3,3a,4,5,8,8a-hexahydroazulen-1(2H)-ylidene]propanoic acid |
| Synonym | Source |
|---|---|
| 2-[(1E,3R,3aR,4S,8aR)-3,4-dihydroxy-3a,6-dimethyl- 1,2,3,3a,4,5,8,8a-octahydroazulen-1-ylidene]propanoic acid | IUPAC |
| Citations |
|---|