EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21O4 |
| Net Charge | -1 |
| Average Mass | 265.329 |
| Monoisotopic Mass | 265.14453 |
| SMILES | [H][C@]12CC=C(C)C[C@H](O)[C@]1(C)[C@H](O)C/C2=C(/C)C(=O)[O-] |
| InChI | InChI=1S/C15H22O4/c1-8-4-5-11-10(9(2)14(18)19)7-13(17)15(11,3)12(16)6-8/h4,11-13,16-17H,5-7H2,1-3H3,(H,18,19)/p-1/b10-9+/t11-,12+,13-,15-/m1/s1 |
| InChIKey | SFKVYZKKPMSRCR-JBOWGTNDSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asperaculane G(1−) (CHEBI:155911) is a monocarboxylic acid anion (CHEBI:35757) |
| asperaculane G(1−) (CHEBI:155911) is conjugate base of asperaculane G (CHEBI:156268) |
| Incoming Relation(s) |
| asperaculane G (CHEBI:156268) is conjugate acid of asperaculane G(1−) (CHEBI:155911) |
| IUPAC Name |
|---|
| (2E)-2-[(3R,3aR,4S,8aR)-3,4-dihydroxy-3a,6-dimethyl-3,3a,4,5,8,8a-hexahydroazulen-1(2H)-ylidene]propanoate |
| UniProt Name | Source |
|---|---|
| asperaculane G | UniProt |
| Citations |
|---|