EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H25O4S |
| Net Charge | -1 |
| Average Mass | 265.395 |
| Monoisotopic Mass | 265.14790 |
| SMILES | CCCCCCC(CCCC)COS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H26O4S/c1-3-5-7-8-10-12(9-6-4-2)11-16-17(13,14)15/h12H,3-11H2,1-2H3,(H,13,14,15)/p-1 |
| InChIKey | CYEJSYGBYQRTPJ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-butyloctyl sulfate (CHEBI:155873) is a organosulfate oxoanion (CHEBI:58958) |
| 2-butyloctyl sulfate (CHEBI:155873) is conjugate base of 2-butyloctyl hydrogen sulfate (CHEBI:155874) |
| Incoming Relation(s) |
| sodium 2-butyloctyl sulfate (CHEBI:155875) has part 2-butyloctyl sulfate (CHEBI:155873) |
| 2-butyloctyl hydrogen sulfate (CHEBI:155874) is conjugate acid of 2-butyloctyl sulfate (CHEBI:155873) |
| IUPAC Name |
|---|
| 2-butyloctyl sulfate |
| UniProt Name | Source |
|---|---|
| 2-butyloctyl sulfate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-21751 | MetaCyc |
| Citations |
|---|