EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H26O4S |
| Net Charge | 0 |
| Average Mass | 266.403 |
| Monoisotopic Mass | 266.15518 |
| SMILES | CCCCCCC(CCCC)COS(=O)(=O)O |
| InChI | InChI=1S/C12H26O4S/c1-3-5-7-8-10-12(9-6-4-2)11-16-17(13,14)15/h12H,3-11H2,1-2H3,(H,13,14,15) |
| InChIKey | CYEJSYGBYQRTPJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | surfactant A substance which lowers the surface tension of the medium in which it is dissolved, and/or the interfacial tension with other phases, and, accordingly, is positively adsorbed at the liquid/vapour and/or at other interfaces. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-butyloctyl hydrogen sulfate (CHEBI:155874) has functional parent 2-butyl-1-octanol (CHEBI:84235) |
| 2-butyloctyl hydrogen sulfate (CHEBI:155874) has role surfactant (CHEBI:35195) |
| 2-butyloctyl hydrogen sulfate (CHEBI:155874) is a alkyl sulfate (CHEBI:29281) |
| 2-butyloctyl hydrogen sulfate (CHEBI:155874) is conjugate acid of 2-butyloctyl sulfate (CHEBI:155873) |
| Incoming Relation(s) |
| 2-butyloctyl sulfate (CHEBI:155873) is conjugate base of 2-butyloctyl hydrogen sulfate (CHEBI:155874) |
| IUPAC Name |
|---|
| 2-butyloctyl hydrogen sulfate |
| Synonyms | Source |
|---|---|
| (2-butyloctyl)oxysulfonic acid | ChEBI |
| [(2-butyloctyl)oxy]sulfonic acid | ChEBI |
| sulfuric acid 2-butyloctyl ester | ChEBI |
| Citations |
|---|