EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H25O4S.Na |
| Net Charge | 0 |
| Average Mass | 288.385 |
| Monoisotopic Mass | 288.13712 |
| SMILES | CCCCCCC(CCCC)COS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C12H26O4S.Na/c1-3-5-7-8-10-12(9-6-4-2)11-16-17(13,14)15;/h12H,3-11H2,1-2H3,(H,13,14,15);/q;+1/p-1 |
| InChIKey | QHVJMQSXCDOHMT-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | surfactant A substance which lowers the surface tension of the medium in which it is dissolved, and/or the interfacial tension with other phases, and, accordingly, is positively adsorbed at the liquid/vapour and/or at other interfaces. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium 2-butyloctyl sulfate (CHEBI:155875) has part 2-butyloctyl sulfate (CHEBI:155873) |
| sodium 2-butyloctyl sulfate (CHEBI:155875) has role surfactant (CHEBI:35195) |
| sodium 2-butyloctyl sulfate (CHEBI:155875) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 2-butyloctyl sulfate |
| Synonyms | Source |
|---|---|
| sodium 2-butyloctyl sulphate | ChemIDplus |
| sulfuric acid 2-butyloctyl sodium salt | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:94200-74-5 | ChemIDplus |
| Citations |
|---|