EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50 |
| Net Charge | 0 |
| Average Mass | 410.730 |
| Monoisotopic Mass | 410.39125 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C30H50/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h15-18,23-24H,9-14,19-22H2,1-8H3/b27-17+,28-18+,29-23+,30-24+ |
| InChIKey | YYGNTYWPHWGJRM-AAJYLUCBSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| squalene (CHEBI:15440) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| squalene (CHEBI:15440) has role human metabolite (CHEBI:77746) |
| squalene (CHEBI:15440) has role mouse metabolite (CHEBI:75771) |
| squalene (CHEBI:15440) has role plant metabolite (CHEBI:76924) |
| squalene (CHEBI:15440) is a triterpene (CHEBI:35191) |
| Incoming Relation(s) |
| 3-methyl-1,2-didehydro-2,3-dihydrosqualene (CHEBI:70860) has functional parent squalene (CHEBI:15440) |
| 3,22-dimethyl-1,2,23,24-tetradehydro-2,3,22,23-tetrahydrosqualene (CHEBI:70861) has functional parent squalene (CHEBI:15440) |
| (R)-12-hydroxysqualene (CHEBI:88123) has parent hydride squalene (CHEBI:15440) |
| (S)-2,3-epoxysqualene (CHEBI:15441) has parent hydride squalene (CHEBI:15440) |
| 2,3-epoxysqualene (CHEBI:78662) has parent hydride squalene (CHEBI:15440) |
| squalene triterpenoid (CHEBI:26747) has parent hydride squalene (CHEBI:15440) |
| tetrahydroxysqualene (CHEBI:66216) has parent hydride squalene (CHEBI:15440) |
| IUPAC Name |
|---|
| (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene |
| Synonyms | Source |
|---|---|
| (all-E)-2,6,10,15,19,23-hexamethyl-2,6,10,14,18,22-tetracosahexaene | NIST Chemistry WebBook |
| Spinacene | KEGG COMPOUND |
| Squalene | KEGG COMPOUND |
| Supraene | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| squalene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003755 | KNApSAcK |
| C00751 | KEGG COMPOUND |
| C00751 | KEGG COMPOUND |
| HMDB0000256 | HMDB |
| LMPR0106010002 | LIPID MAPS |
| SQL | PDBeChem |
| Squalene | Wikipedia |
| SQUALENE | MetaCyc |
| Citations |
|---|