EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H54 |
| Net Charge | 0 |
| Average Mass | 438.784 |
| Monoisotopic Mass | 438.42255 |
| SMILES | C=C(C)C(C)CC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC(C)C(=C)C |
| InChI | InChI=1S/C32H54/c1-25(2)31(9)23-21-29(7)19-13-17-27(5)15-11-12-16-28(6)18-14-20-30(8)22-24-32(10)26(3)4/h15-16,19-20,31-32H,1,3,11-14,17-18,21-24H2,2,4-10H3/b27-15+,28-16+,29-19+,30-20+ |
| InChIKey | LYHFPFHWBXEUPX-AHFVBISTSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,22-dimethyl-1,2,23,24-tetradehydro-2,3,22,23-tetrahydrosqualene (CHEBI:70861) has functional parent squalene (CHEBI:15440) |
| 3,22-dimethyl-1,2,23,24-tetradehydro-2,3,22,23-tetrahydrosqualene (CHEBI:70861) has role metabolite (CHEBI:25212) |
| 3,22-dimethyl-1,2,23,24-tetradehydro-2,3,22,23-tetrahydrosqualene (CHEBI:70861) is a triterpenoid (CHEBI:36615) |
| IUPAC Name |
|---|
| (6E,10E,14E,18E)-2,3,6,10,15,19,22,23-octamethyltetracosa-1,6,10,14,18,23-hexaene |
| UniProt Name | Source |
|---|---|
| 3,22-dimethyl-1,2,23,24-tetradehydro-2,3,22,23-tetrahydrosqualene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-14264 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10395594 | Reaxys |
| Citations |
|---|