EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O4 |
| Net Charge | 0 |
| Average Mass | 474.726 |
| Monoisotopic Mass | 474.37091 |
| SMILES | C/C(=C\CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(CO)CO)CCC=C(CO)CO |
| InChI | InChI=1S/C30H50O4/c1-25(13-7-15-27(3)17-9-19-29(21-31)22-32)11-5-6-12-26(2)14-8-16-28(4)18-10-20-30(23-33)24-34/h11-12,15-16,19-20,31-34H,5-10,13-14,17-18,21-24H2,1-4H3/b25-11+,26-12+,27-15+,28-16+ |
| InChIKey | YMMHDITUHQNNKU-DKTKHUEWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhus taitensis (ncbitaxon:384978) | |||
| leaf (BTO:0000713) | PubMed (18710283) | ||
| twig (BTO:0001411) | PubMed (18710283) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| Application: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahydroxysqualene (CHEBI:66216) has parent hydride squalene (CHEBI:15440) |
| tetrahydroxysqualene (CHEBI:66216) has role antimycobacterial drug (CHEBI:64912) |
| tetrahydroxysqualene (CHEBI:66216) has role metabolite (CHEBI:25212) |
| tetrahydroxysqualene (CHEBI:66216) is a primary alcohol (CHEBI:15734) |
| tetrahydroxysqualene (CHEBI:66216) is a tetrol (CHEBI:33573) |
| tetrahydroxysqualene (CHEBI:66216) is a triterpenoid (CHEBI:36615) |
| IUPAC Name |
|---|
| (6E,10E,14E,18E)-2,23-bis(hydroxymethyl)-6,10,15,19-tetramethyltetracosa-2,6,10,14,18,22-hexaene-1,24-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19220861 | Reaxys |
| Citations |
|---|