EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15420 - perillyl alcohol
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | C=C(C)C1CC=C(CO)CC1 |
| InChI | InChI=1S/C10H16O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,10-11H,1,4-7H2,2H3 |
| InChIKey | NDTYTMIUWGWIMO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perillyl alcohol (CHEBI:15420) has role plant metabolite (CHEBI:76924) |
| perillyl alcohol (CHEBI:15420) has role volatile oil component (CHEBI:27311) |
| perillyl alcohol (CHEBI:15420) is a limonene monoterpenoid (CHEBI:25040) |
| Incoming Relation(s) |
| (R)-(+)-perillyl alcohol (CHEBI:145806) is a perillyl alcohol (CHEBI:15420) |
| (S)-(−)-perillyl alcohol (CHEBI:10782) is a perillyl alcohol (CHEBI:15420) |
| IUPAC Name |
|---|
| [4-(prop-1-en-2-yl)cyclohex-1-en-1-yl]methanol |
| Synonyms | Source |
|---|---|
| Perilla alcohol | ChemIDplus |
| Isocarveol | ChemIDplus |
| Perillol | ChemIDplus |
| p-Mentha-1,8-dien-7-ol | ChemIDplus |
| 1-Hydroxymethyl-4-isopropenyl-1-cyclohexene | ChemIDplus |
| 4-(1-Methylethenyl)-1-cyclohexene-1-methanol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| perillyl alcohol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Perillyl-Alcohols | MetaCyc |
| HMDB0003634 | HMDB |
| Citations |
|---|