EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | C=C(C)[C@@H]1CC=C(CO)CC1 |
| InChI | InChI=1S/C10H16O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,10-11H,1,4-7H2,2H3/t10-/m1/s1 |
| InChIKey | NDTYTMIUWGWIMO-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-(−)-perillyl alcohol (CHEBI:10782) is a perillyl alcohol (CHEBI:15420) |
| (S)-(−)-perillyl alcohol (CHEBI:10782) is enantiomer of (R)-(+)-perillyl alcohol (CHEBI:145806) |
| Incoming Relation(s) |
| (R)-(+)-perillyl alcohol (CHEBI:145806) is enantiomer of (S)-(−)-perillyl alcohol (CHEBI:10782) |
| IUPAC Name |
|---|
| [(4S)-4-(prop-1-en-2-yl)cyclohex-1-en-1-yl]methanol |
| Synonyms | Source |
|---|---|
| 4-isopropenylcyclohex-1-en-1-ylmethanol | ChEBI |
| (-)-Perillylalcohol | KEGG COMPOUND |
| Perillyl alcohol | KEGG COMPOUND |
| p-Mentha-1,8-dien-7-ol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (4S)-perillyl alcohol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00010885 | KNApSAcK |
| C02452 | KEGG COMPOUND |
| CPD-261 | MetaCyc |
| LMPR0102090008 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2501605 | Reaxys |
| CAS:18457-55-1 | KEGG COMPOUND |
| CAS:536-59-4 | KEGG COMPOUND |
| Citations |
|---|