EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | [H][C@]1(C(=C)C)CC=C(CO)CC1 |
| InChI | InChI=1S/C10H16O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,10-11H,1,4-7H2,2H3/t10-/m0/s1 |
| InChIKey | NDTYTMIUWGWIMO-JTQLQIEISA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-(+)-perillyl alcohol (CHEBI:145806) has role plant metabolite (CHEBI:76924) |
| (R)-(+)-perillyl alcohol (CHEBI:145806) is a perillyl alcohol (CHEBI:15420) |
| (R)-(+)-perillyl alcohol (CHEBI:145806) is enantiomer of (S)-(−)-perillyl alcohol (CHEBI:10782) |
| Incoming Relation(s) |
| (S)-(−)-perillyl alcohol (CHEBI:10782) is enantiomer of (R)-(+)-perillyl alcohol (CHEBI:145806) |
| IUPAC Name |
|---|
| [(4R)-4-(prop-1-en-2-yl)cyclohex-1-en-1-yl]methanol |
| Synonyms | Source |
|---|---|
| (4R)-perillyl alcohol | ChEBI |
| d-perillyl alcohol | ChEBI |
| (R)-p-mentha-1,8-dien-7-ol | ChEBI |
| (R)-perillyl alcohol | ChEBI |
| (+)-perillyl alcohol | ChEBI |
| UniProt Name | Source |
|---|---|
| (4R)-perillyl alcohol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00010884 | KNApSAcK |
| CPD-17084 | MetaCyc |
| FDB014924 | FooDB |
| HMDB0036087 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:57717-97-2 | KNApSAcK |
| Citations |
|---|