EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O3 |
| Net Charge | 0 |
| Average Mass | 138.122 |
| Monoisotopic Mass | 138.03169 |
| SMILES | O=C(O)c1cccc(O)c1 |
| InChI | InChI=1S/C7H6O3/c8-6-3-1-2-5(4-6)7(9)10/h1-4,8H,(H,9,10) |
| InChIKey | IJFXRHURBJZNAO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxybenzoic acid (CHEBI:30764) has functional parent benzoic acid (CHEBI:30746) |
| 3-hydroxybenzoic acid (CHEBI:30764) has role bacterial metabolite (CHEBI:76969) |
| 3-hydroxybenzoic acid (CHEBI:30764) has role plant metabolite (CHEBI:76924) |
| 3-hydroxybenzoic acid (CHEBI:30764) is a monohydroxybenzoic acid (CHEBI:25389) |
| 3-hydroxybenzoic acid (CHEBI:30764) is conjugate acid of 3-hydroxybenzoate (CHEBI:16193) |
| Incoming Relation(s) |
| 3-hydroxybenzoyl-CoA (CHEBI:15484) has functional parent 3-hydroxybenzoic acid (CHEBI:30764) |
| 3-methoxybenzoic acid (CHEBI:88458) has functional parent 3-hydroxybenzoic acid (CHEBI:30764) |
| methyl 3-hydroxybenzoate (CHEBI:165218) has functional parent 3-hydroxybenzoic acid (CHEBI:30764) |
| WZB-117 (CHEBI:229781) has functional parent 3-hydroxybenzoic acid (CHEBI:30764) |
| 3-hydroxybenzoate (CHEBI:16193) is conjugate base of 3-hydroxybenzoic acid (CHEBI:30764) |
| IUPAC Name |
|---|
| 3-hydroxybenzoic acid |
| Synonyms | Source |
|---|---|
| m-Hydroxybenzoic acid | KEGG COMPOUND |
| m-hydroxybenzoic acid | NIST Chemistry WebBook |
| m-salicylic acid | NIST Chemistry WebBook |
| 3-carboxyphenol | NIST Chemistry WebBook |
| 3-HYDROXYBENZOIC ACID | PDBeChem |
| 3-Hydroxybenzoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00587 | KEGG COMPOUND |
| 3HB | PDBeChem |
| 3-Hydroxybenzoic_acid | Wikipedia |
| HMDB0002466 | HMDB |
| C00040822 | KNApSAcK |
| Citations |
|---|