EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H13FO6 |
| Net Charge | 0 |
| Average Mass | 368.316 |
| Monoisotopic Mass | 368.06962 |
| SMILES | O=C(Oc1cccc(F)c1OC(=O)c1cccc(O)c1)c1cccc(O)c1 |
| InChI | InChI=1S/C20H13FO6/c21-16-8-3-9-17(26-19(24)12-4-1-6-14(22)10-12)18(16)27-20(25)13-5-2-7-15(23)11-13/h1-11,22-23H |
| InChIKey | FRSWCCBXIHFKKY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | glucose transporter 1 inhibitor Any glucose transporter inhibitor that interferes with the action of glucose transporter 1. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| WZB-117 (CHEBI:229781) has functional parent 3-fluorocatechol (CHEBI:39876) |
| WZB-117 (CHEBI:229781) has functional parent 3-hydroxybenzoic acid (CHEBI:30764) |
| WZB-117 (CHEBI:229781) has role antineoplastic agent (CHEBI:35610) |
| WZB-117 (CHEBI:229781) has role glucose transporter 1 inhibitor (CHEBI:229783) |
| WZB-117 (CHEBI:229781) has role radiosensitizing agent (CHEBI:132992) |
| WZB-117 (CHEBI:229781) is a benzoate ester (CHEBI:36054) |
| WZB-117 (CHEBI:229781) is a diester (CHEBI:51307) |
| WZB-117 (CHEBI:229781) is a monofluorobenzenes (CHEBI:83575) |
| WZB-117 (CHEBI:229781) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3-fluorobenzene-1,2-diyl bis(3-hydroxybenzoate) |
| Synonyms | Source |
|---|---|
| 3-fluoro-1,2-phenylene bis(3-hydroxybenzoate) | IUPAC |
| 3-hydroxy-benzoic acid 1,1'-(3-fluoro-1,2-phenylene) ester | ChEBI |
| WZB 117 | ChEBI |
| WZB117 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| DB16764 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:1223397-11-2 | ChEBI |
| Citations |
|---|