EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O3 |
| Net Charge | 0 |
| Average Mass | 152.149 |
| Monoisotopic Mass | 152.04734 |
| SMILES | COC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C8H8O3/c1-11-8(10)6-3-2-4-7(9)5-6/h2-5,9H,1H3 |
| InChIKey | YKUCHDXIBAQWSF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 3-hydroxybenzoate (CHEBI:165218) has functional parent 3-hydroxybenzoic acid (CHEBI:30764) |
| methyl 3-hydroxybenzoate (CHEBI:165218) has role antibacterial agent (CHEBI:33282) |
| methyl 3-hydroxybenzoate (CHEBI:165218) is a benzoate ester (CHEBI:36054) |
| methyl 3-hydroxybenzoate (CHEBI:165218) is a methyl ester (CHEBI:25248) |
| methyl 3-hydroxybenzoate (CHEBI:165218) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| methyl 3-hydroxybenzoate |
| Synonyms | Source |
|---|---|
| m-hydroxybenzoic acid methyl ester | ChemIDplus |
| m-carbomethoxyphenol | ChemIDplus |
| 3-hydroxybenzoic acid methyl ester | ChemIDplus |
| 3-(methoxycarbonyl)phenol | NIST Chemistry WebBook |
| 3-carbomethoxyphenol | ChEBI |
| m-carbomethoxyphenol | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 79453 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2208129 | Reaxys |
| CAS:19438-10-9 | NIST Chemistry WebBook |
| CAS:19438-10-9 | ChemIDplus |
| Citations |
|---|