EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16193 - 3-hydroxybenzoate
| Formula | C7H5O3 |
| Net Charge | -1 |
| Average Mass | 137.114 |
| Monoisotopic Mass | 137.02442 |
| SMILES | O=C([O-])c1cccc(O)c1 |
| InChI | InChI=1S/C7H6O3/c8-6-3-1-2-5(4-6)7(9)10/h1-4,8H,(H,9,10)/p-1 |
| InChIKey | IJFXRHURBJZNAO-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxybenzoate (CHEBI:16193) has functional parent benzoate (CHEBI:16150) |
| 3-hydroxybenzoate (CHEBI:16193) has role bacterial metabolite (CHEBI:76969) |
| 3-hydroxybenzoate (CHEBI:16193) has role plant metabolite (CHEBI:76924) |
| 3-hydroxybenzoate (CHEBI:16193) is a monohydroxybenzoate (CHEBI:25388) |
| 3-hydroxybenzoate (CHEBI:16193) is conjugate base of 3-hydroxybenzoic acid (CHEBI:30764) |
| Incoming Relation(s) |
| 3-hydroxybenzoyl-AMP(1−) (CHEBI:188494) has functional parent 3-hydroxybenzoate (CHEBI:16193) |
| 3-hydroxybenzoic acid (CHEBI:30764) is conjugate acid of 3-hydroxybenzoate (CHEBI:16193) |
| IUPAC Name |
|---|
| 3-hydroxybenzoate |
| UniProt Name | Source |
|---|---|
| 3-hydroxybenzoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00587 | KEGG COMPOUND |
| c0187 | UM-BBD |
| 3-HYDROXYBENZOATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:327380 | Gmelin |
| Reaxys:3904772 | Reaxys |